C19H30N2O3 — CID 174928987
benzyl 6-amino-2-(hexanoylamino)hexanoate (PubChem CID 174928987) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is benzyl 6-amino-2-(hexanoylamino)hexanoate.
| Compound Name | benzyl 6-amino-2-(hexanoylamino)hexanoate |
|---|---|
| PubChem CID | 174928987 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | benzyl 6-amino-2-(hexanoylamino)hexanoate |
| SMILES | CCCCCC(=O)NC(CCCCN)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H30N2O3/c1-2-3-5-13-18(22)21-17(12-8-9-14-20)19(23)24-15-16-10-6-4-7-11-16/h4,6-7,10-11,17H,2-3,5,8-9,12-15,20H2,1H3,(H,21,22) |
| InChIKey | PBHTWTXVHMJBRO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|