C26H35NO4 — CID 6709913
benzyl (2S)-2-(decanoylamino)-3-(4-hydroxyphenyl)propanoate (PubChem CID 6709913) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is benzyl (2S)-2-(decanoylamino)-3-(4-hydroxyphenyl)propanoate.
| Compound Name | benzyl (2S)-2-(decanoylamino)-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 6709913 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | benzyl (2S)-2-(decanoylamino)-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCCCCCCCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H35NO4/c1-2-3-4-5-6-7-11-14-25(29)27-24(19-21-15-17-23(28)18-16-21)26(30)31-20-22-12-9-8-10-13-22/h8-10,12-13,15-18,24,28H,2-7,11,14,19-20H2,1H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | VQIKMPZJMXJQPH-DEOSSOPVSA-N |
| XLogP | 5.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|