C28H39NO8 — CID 170258051
benzyl (2S)-3-(4-hydroxyphenyl)-2-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]propanoate (PubChem CID 170258051) has the molecular formula C28H39NO8 and a molecular weight of 517.62 g/mol. Its IUPAC name is benzyl (2S)-3-(4-hydroxyphenyl)-2-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]propanoate.
| Compound Name | benzyl (2S)-3-(4-hydroxyphenyl)-2-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]propanoate |
|---|---|
| PubChem CID | 170258051 |
| Molecular Formula | C28H39NO8 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | benzyl (2S)-3-(4-hydroxyphenyl)-2-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]propanoate |
| SMILES | CCCOCCOCCOCCOCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H39NO8/c1-2-13-33-15-17-35-19-20-36-18-16-34-14-12-27(31)29-26(21-23-8-10-25(30)11-9-23)28(32)37-22-24-6-4-3-5-7-24/h3-11,26,30H,2,12-22H2,1H3,(H,29,31)/t26-/m0/s1 |
| InChIKey | DWKLDXOPBNPKSQ-SANMLTNESA-N |
| XLogP | 3.03 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|