C26H27NO4 — CID 18468105
ethyl 2-(3,3-diphenylpropanoylamino)-3-(4-hydroxyphenyl)propanoate (PubChem CID 18468105) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is ethyl 2-(3,3-diphenylpropanoylamino)-3-(4-hydroxyphenyl)propanoate.
| Compound Name | ethyl 2-(3,3-diphenylpropanoylamino)-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 18468105 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | ethyl 2-(3,3-diphenylpropanoylamino)-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)NC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c1-2-31-26(30)24(17-19-13-15-22(28)16-14-19)27-25(29)18-23(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,23-24,28H,2,17-18H2,1H3,(H,27,29) |
| InChIKey | RZNIPUOEYXBRHJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |