C19H21NO6 — CID 70496078
ethyl (2S)-2-[[2-(4-hydroxyphenoxy)acetyl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 70496078) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(4-hydroxyphenoxy)acetyl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | ethyl (2S)-2-[[2-(4-hydroxyphenoxy)acetyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 70496078 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl (2S)-2-[[2-(4-hydroxyphenoxy)acetyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)COc1ccc(O)cc1 |
| InChI | InChI=1S/C19H21NO6/c1-2-25-19(24)17(11-13-3-5-14(21)6-4-13)20-18(23)12-26-16-9-7-15(22)8-10-16/h3-10,17,21-22H,2,11-12H2,1H3,(H,20,23)/t17-/m0/s1 |
| InChIKey | ZZIUKFYACXMYBR-KRWDZBQOSA-N |
| XLogP | 1.77 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |