C13H19NO5 — CID 2723594
ethyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate (PubChem CID 2723594) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is ethyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate.
| Compound Name | ethyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate |
|---|---|
| PubChem CID | 2723594 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | ethyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O.O |
| InChI | InChI=1S/C13H17NO4.H2O/c1-3-18-13(17)12(14-9(2)15)8-10-4-6-11(16)7-5-10;/h4-7,12,16H,3,8H2,1-2H3,(H,14,15);1H2/t12-;/m0./s1 |
| InChIKey | YWAVLHZJMWEYTA-YDALLXLXSA-N |
| XLogP | 0.18 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |