C18H26N2O5 — CID 541920
butyl 2-(2-acetamidopropanoylamino)-3-(4-hydroxyphenyl)propanoate (PubChem CID 541920) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is butyl 2-(2-acetamidopropanoylamino)-3-(4-hydroxyphenyl)propanoate.
| Compound Name | butyl 2-(2-acetamidopropanoylamino)-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 541920 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | butyl 2-(2-acetamidopropanoylamino)-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCCCOC(=O)C(Cc1ccc(O)cc1)NC(=O)C(C)NC(C)=O |
| InChI | InChI=1S/C18H26N2O5/c1-4-5-10-25-18(24)16(11-14-6-8-15(22)9-7-14)20-17(23)12(2)19-13(3)21/h6-9,12,16,22H,4-5,10-11H2,1-3H3,(H,19,21)(H,20,23) |
| InChIKey | FOEHRUUKKUQROD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|