C15H21NO6 — CID 141436930
methyl (2R)-2-(butoxycarbonylamino)-3-(4-hydroxyphenyl)propaneperoxoate (PubChem CID 141436930) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is methyl (2R)-2-(butoxycarbonylamino)-3-(4-hydroxyphenyl)propaneperoxoate.
| Compound Name | methyl (2R)-2-(butoxycarbonylamino)-3-(4-hydroxyphenyl)propaneperoxoate |
|---|---|
| PubChem CID | 141436930 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | methyl (2R)-2-(butoxycarbonylamino)-3-(4-hydroxyphenyl)propaneperoxoate |
| SMILES | CCCCOC(=O)N[C@H](Cc1ccc(O)cc1)C(=O)OOC |
| InChI | InChI=1S/C15H21NO6/c1-3-4-9-21-15(19)16-13(14(18)22-20-2)10-11-5-7-12(17)8-6-11/h5-8,13,17H,3-4,9-10H2,1-2H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | UTUVWEAENQLBLC-CYBMUJFWSA-N |
| XLogP | 1.93 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|