C20H23NO4 — CID 101068161
butyl (2S)-2-benzamido-3-(4-hydroxyphenyl)propanoate (PubChem CID 101068161) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is butyl (2S)-2-benzamido-3-(4-hydroxyphenyl)propanoate.
| Compound Name | butyl (2S)-2-benzamido-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 101068161 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | butyl (2S)-2-benzamido-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCCCOC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NO4/c1-2-3-13-25-20(24)18(14-15-9-11-17(22)12-10-15)21-19(23)16-7-5-4-6-8-16/h4-12,18,22H,2-3,13-14H2,1H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | QTVXJMRRUPPXTA-SFHVURJKSA-N |
| XLogP | 3.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|