C22H27NO3 — CID 569464
hexyl 2-benzamido-3-phenylpropanoate (PubChem CID 569464) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is hexyl 2-benzamido-3-phenylpropanoate.
| Compound Name | hexyl 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 569464 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | hexyl 2-benzamido-3-phenylpropanoate |
| SMILES | CCCCCCOC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c1-2-3-4-11-16-26-22(25)20(17-18-12-7-5-8-13-18)23-21(24)19-14-9-6-10-15-19/h5-10,12-15,20H,2-4,11,16-17H2,1H3,(H,23,24) |
| InChIKey | NZEINZQADWNFRY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|