C24H29N3O7 — CID 87109942
octyl (2S)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoate (PubChem CID 87109942) has the molecular formula C24H29N3O7 and a molecular weight of 471.51 g/mol. Its IUPAC name is octyl (2S)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | octyl (2S)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 87109942 |
| Molecular Formula | C24H29N3O7 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | octyl (2S)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoate |
| SMILES | CCCCCCCCOC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H29N3O7/c1-2-3-4-5-6-10-13-34-24(29)22(14-18-11-8-7-9-12-18)25-23(28)19-15-20(26(30)31)17-21(16-19)27(32)33/h7-9,11-12,15-17,22H,2-6,10,13-14H2,1H3,(H,25,28)/t22-/m0/s1 |
| InChIKey | VLUUCDDFBRSVEP-QFIPXVFZSA-N |
| XLogP | 4.75 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|