(2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid

C16H13N3O7 — CID 7039897

IUPAC(2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid
SMILESO=C(N[C@H](Cc1ccccc1)C(=O)O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1
InChIInChI=1S/C16H13N3O7/c20-15(11-7-12(18(23)24)9-13(8-11)19(25)26)17-14(16(21)22)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2,(H,17,20)(H,21,22)/t14-/m1/s1
InChIKeyHMPNOOCHYKCCQH-CQSZACIVSA-N
MW359.29 g/mol
LogP1.93
Rot. Bonds7

About (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid

(2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid (PubChem CID 7039897) has the molecular formula C16H13N3O7 and a molecular weight of 359.29 g/mol. Its IUPAC name is (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid.

Molecular Properties

Compound Name(2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid
PubChem CID7039897
Molecular FormulaC16H13N3O7
Molecular Weight359.29 g/mol
Exact Mass359.08
IUPAC Name(2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid
SMILESO=C(N[C@H](Cc1ccccc1)C(=O)O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1
InChIInChI=1S/C16H13N3O7/c20-15(11-7-12(18(23)24)9-13(8-11)19(25)26)17-14(16(21)22)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2,(H,17,20)(H,21,22)/t14-/m1/s1
InChIKeyHMPNOOCHYKCCQH-CQSZACIVSA-N
XLogP1.93
TPSA152.68 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500359.29
LogP ≤ 51.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid?
The IUPAC name of (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid (CID 7039897) is (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid.
What is the SMILES notation for (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid?
The canonical SMILES for (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid is O=C(N[C@H](Cc1ccccc1)C(=O)O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.
What is the InChIKey of (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid?
The InChIKey is HMPNOOCHYKCCQH-CQSZACIVSA-N. The full InChI is InChI=1S/C16H13N3O7/c20-15(11-7-12(18(23)24)9-13(8-11)19(25)26)17-14(16(21)22)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2,(H,17,20)(H,21,22)/t14-/m1/s1.
What are the key properties of (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid?
(2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid has a molecular weight of 359.29 g/mol, XLogP of 1.93, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid is sourced from PubChem (CID 7039897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).