C16H13N3O7 — CID 7039897
(2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid (PubChem CID 7039897) has the molecular formula C16H13N3O7 and a molecular weight of 359.29 g/mol. Its IUPAC name is (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 7039897 |
| Molecular Formula | C16H13N3O7 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N3O7/c20-15(11-7-12(18(23)24)9-13(8-11)19(25)26)17-14(16(21)22)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2,(H,17,20)(H,21,22)/t14-/m1/s1 |
| InChIKey | HMPNOOCHYKCCQH-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|