C14H11N3O5 — CID 71606848
N-benzyl-3,5-dinitro(11C)benzamide (PubChem CID 71606848) has the molecular formula C14H11N3O5 and a molecular weight of 300.26 g/mol. Its IUPAC name is N-benzyl-3,5-dinitro(11C)benzamide.
| Compound Name | N-benzyl-3,5-dinitro(11C)benzamide |
|---|---|
| PubChem CID | 71606848 |
| Molecular Formula | C14H11N3O5 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-benzyl-3,5-dinitro(11C)benzamide |
| SMILES | O=[11C](NCc1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11N3O5/c18-14(15-9-10-4-2-1-3-5-10)11-6-12(16(19)20)8-13(7-11)17(21)22/h1-8H,9H2,(H,15,18)/i14-1 |
| InChIKey | IKLMVWNXNBFJRE-UMSOTBISSA-N |
| XLogP | 2.43 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|