C14H12N2O5 — CID 18990399
N-benzyl-3,4-dihydroxy-5-nitrobenzamide (PubChem CID 18990399) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is N-benzyl-3,4-dihydroxy-5-nitrobenzamide.
| Compound Name | N-benzyl-3,4-dihydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 18990399 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-benzyl-3,4-dihydroxy-5-nitrobenzamide |
| SMILES | O=C(NCc1ccccc1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N2O5/c17-12-7-10(6-11(13(12)18)16(20)21)14(19)15-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2,(H,15,19) |
| InChIKey | CCRNCWDQAOTBHN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|