C15H14N2O5 — CID 174517871
3,4-dihydroxy-5-nitro-N-(2-phenylethyl)benzamide (PubChem CID 174517871) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is 3,4-dihydroxy-5-nitro-N-(2-phenylethyl)benzamide.
| Compound Name | 3,4-dihydroxy-5-nitro-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 174517871 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3,4-dihydroxy-5-nitro-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N2O5/c18-13-9-11(8-12(14(13)19)17(21)22)15(20)16-7-6-10-4-2-1-3-5-10/h1-5,8-9,18-19H,6-7H2,(H,16,20) |
| InChIKey | PDBCDOXSJCVZMI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|