C21H17FN2O6 — CID 175444405
N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3,4-dihydroxy-5-nitrobenzamide (PubChem CID 175444405) has the molecular formula C21H17FN2O6 and a molecular weight of 412.37 g/mol. Its IUPAC name is N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3,4-dihydroxy-5-nitrobenzamide.
| Compound Name | N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3,4-dihydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 175444405 |
| Molecular Formula | C21H17FN2O6 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3,4-dihydroxy-5-nitrobenzamide |
| SMILES | O=C(NCc1ccc(OCc2cccc(F)c2)cc1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17FN2O6/c22-16-3-1-2-14(8-16)12-30-17-6-4-13(5-7-17)11-23-21(27)15-9-18(24(28)29)20(26)19(25)10-15/h1-10,25-26H,11-12H2,(H,23,27) |
| InChIKey | ZROCACPNORYXRA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|