C20H23N3O3 — CID 27647096
3-nitro-N-(3-phenylpropyl)-4-pyrrolidin-1-ylbenzamide (PubChem CID 27647096) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-nitro-N-(3-phenylpropyl)-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-nitro-N-(3-phenylpropyl)-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 27647096 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-nitro-N-(3-phenylpropyl)-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23N3O3/c24-20(21-12-6-9-16-7-2-1-3-8-16)17-10-11-18(19(15-17)23(25)26)22-13-4-5-14-22/h1-3,7-8,10-11,15H,4-6,9,12-14H2,(H,21,24) |
| InChIKey | AWUVBQAYJMAWIX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|