C26H35N3O3S — CID 46349231
N-(3-phenylpropyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 46349231) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is N-(3-phenylpropyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3-phenylpropyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46349231 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-(3-phenylpropyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C26H35N3O3S/c30-26(27-16-10-13-22-11-4-1-5-12-22)23-14-15-24(28-17-6-2-7-18-28)25(21-23)33(31,32)29-19-8-3-9-20-29/h1,4-5,11-12,14-15,21H,2-3,6-10,13,16-20H2,(H,27,30) |
| InChIKey | GIYIBIJWRILUOE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|