C23H32N6O3S — CID 38819154
4-piperidin-1-yl-3-piperidin-1-ylsulfonyl-N-[2-(pyrazin-2-ylamino)ethyl]benzamide (PubChem CID 38819154) has the molecular formula C23H32N6O3S and a molecular weight of 472.62 g/mol. Its IUPAC name is 4-piperidin-1-yl-3-piperidin-1-ylsulfonyl-N-[2-(pyrazin-2-ylamino)ethyl]benzamide.
| Compound Name | 4-piperidin-1-yl-3-piperidin-1-ylsulfonyl-N-[2-(pyrazin-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 38819154 |
| Molecular Formula | C23H32N6O3S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 4-piperidin-1-yl-3-piperidin-1-ylsulfonyl-N-[2-(pyrazin-2-ylamino)ethyl]benzamide |
| SMILES | O=C(NCCNc1cnccn1)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C23H32N6O3S/c30-23(27-12-11-26-22-18-24-9-10-25-22)19-7-8-20(28-13-3-1-4-14-28)21(17-19)33(31,32)29-15-5-2-6-16-29/h7-10,17-18H,1-6,11-16H2,(H,25,26)(H,27,30) |
| InChIKey | ZXRZAKQPGZTDIN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|