C23H27F2N3O3S — CID 55451008
N-(2,6-difluorophenyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 55451008) has the molecular formula C23H27F2N3O3S and a molecular weight of 463.55 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2,6-difluorophenyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55451008 |
| Molecular Formula | C23H27F2N3O3S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C23H27F2N3O3S/c24-18-8-7-9-19(25)22(18)26-23(29)17-10-11-20(27-12-3-1-4-13-27)21(16-17)32(30,31)28-14-5-2-6-15-28/h7-11,16H,1-6,12-15H2,(H,26,29) |
| InChIKey | ACMMEAFBEPDIIQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |