C23H27ClFN3O3S — CID 46349261
N-(4-chloro-2-fluorophenyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 46349261) has the molecular formula C23H27ClFN3O3S and a molecular weight of 480.01 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46349261 |
| Molecular Formula | C23H27ClFN3O3S |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C23H27ClFN3O3S/c24-18-8-9-20(19(25)16-18)26-23(29)17-7-10-21(27-11-3-1-4-12-27)22(15-17)32(30,31)28-13-5-2-6-14-28/h7-10,15-16H,1-6,11-14H2,(H,26,29) |
| InChIKey | UGOHRFMSQJSDTL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |