C25H31N3O5S — CID 46349228
methyl 2-[(4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoyl)amino]benzoate (PubChem CID 46349228) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is methyl 2-[(4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoyl)amino]benzoate.
| Compound Name | methyl 2-[(4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 46349228 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | methyl 2-[(4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C25H31N3O5S/c1-33-25(30)20-10-4-5-11-21(20)26-24(29)19-12-13-22(27-14-6-2-7-15-27)23(18-19)34(31,32)28-16-8-3-9-17-28/h4-5,10-13,18H,2-3,6-9,14-17H2,1H3,(H,26,29) |
| InChIKey | ATEZCYHMMJUENC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |