C20H29N3O3S — CID 27005624
N-cyclopropyl-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 27005624) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is N-cyclopropyl-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-cyclopropyl-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 27005624 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-cyclopropyl-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NC1CC1)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H29N3O3S/c24-20(21-17-8-9-17)16-7-10-18(22-11-3-1-4-12-22)19(15-16)27(25,26)23-13-5-2-6-14-23/h7,10,15,17H,1-6,8-9,11-14H2,(H,21,24) |
| InChIKey | LRSPTNJGOUYTRY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |