C23H33N3O5S — CID 46648957
[1-(cyclopropylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 46648957) has the molecular formula C23H33N3O5S and a molecular weight of 463.60 g/mol. Its IUPAC name is [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 46648957 |
| Molecular Formula | C23H33N3O5S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C23H33N3O5S/c1-17(22(27)24-19-9-10-19)31-23(28)18-8-11-20(25-12-4-2-5-13-25)21(16-18)32(29,30)26-14-6-3-7-15-26/h8,11,16-17,19H,2-7,9-10,12-15H2,1H3,(H,24,27) |
| InChIKey | ACCLXDIRRGFQLK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |