C20H28N2O6S — CID 3959551
[1-(cyclopentylamino)-1-oxopropan-2-yl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 3959551) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3959551 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)OC(C)C(=O)NC2CCCC2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H28N2O6S/c1-14(19(23)21-16-7-3-4-8-16)28-20(24)15-9-10-17(27-2)18(13-15)29(25,26)22-11-5-6-12-22/h9-10,13-14,16H,3-8,11-12H2,1-2H3,(H,21,23) |
| InChIKey | YDUIRVPEEHVRGP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |