C18H26N2O7S — CID 8722389
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8722389) has the molecular formula C18H26N2O7S and a molecular weight of 414.48 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8722389 |
| Molecular Formula | C18H26N2O7S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)O[C@@H](C)C(=O)NC2CCCC2)cc1S(=O)(=O)N(C)OC |
| InChI | InChI=1S/C18H26N2O7S/c1-12(17(21)19-14-7-5-6-8-14)27-18(22)13-9-10-15(25-3)16(11-13)28(23,24)20(2)26-4/h9-12,14H,5-8H2,1-4H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | OXZSYHQATPMJOA-LBPRGKRZSA-N |
| XLogP | 1.48 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|