C17H24N2O7S — CID 8631230
[2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8631230) has the molecular formula C17H24N2O7S and a molecular weight of 400.45 g/mol. Its IUPAC name is [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8631230 |
| Molecular Formula | C17H24N2O7S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N[C@H](C)C2CC2)cc1S(=O)(=O)N(C)OC |
| InChI | InChI=1S/C17H24N2O7S/c1-11(12-5-6-12)18-16(20)10-26-17(21)13-7-8-14(24-3)15(9-13)27(22,23)19(2)25-4/h7-9,11-12H,5-6,10H2,1-4H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | XJJRJTHFHUDBAI-LLVKDONJSA-N |
| XLogP | 0.95 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|