C17H19NO7S2 — CID 8722413
[2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8722413) has the molecular formula C17H19NO7S2 and a molecular weight of 413.47 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8722413 |
| Molecular Formula | C17H19NO7S2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-methoxy-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2ccc(C)s2)cc1S(=O)(=O)N(C)OC |
| InChI | InChI=1S/C17H19NO7S2/c1-11-5-8-15(26-11)13(19)10-25-17(20)12-6-7-14(23-3)16(9-12)27(21,22)18(2)24-4/h5-9H,10H2,1-4H3 |
| InChIKey | HQCNDYPRCBANIN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|