C19H21NO6S2 — CID 55379181
[2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 55379181) has the molecular formula C19H21NO6S2 and a molecular weight of 423.51 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55379181 |
| Molecular Formula | C19H21NO6S2 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2ccc(C)s2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C19H21NO6S2/c1-13-5-8-17(27-13)15(21)12-26-19(22)14-6-7-16(25-2)18(11-14)28(23,24)20-9-3-4-10-20/h5-8,11H,3-4,9-10,12H2,1-2H3 |
| InChIKey | NSIOTOVKFMKUKX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |