C15H20N2O6S — CID 18074318
[2-(methylamino)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 18074318) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 18074318 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CNC(=O)COC(=O)c1ccc(OC)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C15H20N2O6S/c1-16-14(18)10-23-15(19)11-5-6-12(22-2)13(9-11)24(20,21)17-7-3-4-8-17/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,16,18) |
| InChIKey | IESRNKLFAXQZPL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |