C19H28N2O7S — CID 42964173
[2-(2-methoxyethylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate (PubChem CID 42964173) has the molecular formula C19H28N2O7S and a molecular weight of 428.51 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 42964173 |
| Molecular Formula | C19H28N2O7S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate |
| SMILES | COCCNC(=O)COC(=O)c1ccc(OC)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C19H28N2O7S/c1-26-12-9-20-18(22)14-28-19(23)15-7-8-16(27-2)17(13-15)29(24,25)21-10-5-3-4-6-11-21/h7-8,13H,3-6,9-12,14H2,1-2H3,(H,20,22) |
| InChIKey | ZVYJUYWWTXIXSC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|