C20H30N2O6S — CID 16509189
[2-(diethylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate (PubChem CID 16509189) has the molecular formula C20H30N2O6S and a molecular weight of 426.54 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 16509189 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate |
| SMILES | CCN(CC)C(=O)COC(=O)c1ccc(OC)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C20H30N2O6S/c1-4-21(5-2)19(23)15-28-20(24)16-10-11-17(27-3)18(14-16)29(25,26)22-12-8-6-7-9-13-22/h10-11,14H,4-9,12-13,15H2,1-3H3 |
| InChIKey | GKFZMGKTTMZNHP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |