C20H27FN2O5S — CID 55315959
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 55315959) has the molecular formula C20H27FN2O5S and a molecular weight of 426.51 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55315959 |
| Molecular Formula | C20H27FN2O5S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H27FN2O5S/c1-4-22(13-15(2)3)19(24)14-28-20(25)16-8-9-17(21)18(12-16)29(26,27)23-10-6-5-7-11-23/h8-9,12H,2,4-7,10-11,13-14H2,1,3H3 |
| InChIKey | PDJMPMUOOPZQFY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|