C20H19F3N2O5S — CID 23877745
[2-(2,5-difluoroanilino)-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 23877745) has the molecular formula C20H19F3N2O5S and a molecular weight of 456.44 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 23877745 |
| Molecular Formula | C20H19F3N2O5S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C20H19F3N2O5S/c21-14-5-7-15(22)17(11-14)24-19(26)12-30-20(27)13-4-6-16(23)18(10-13)31(28,29)25-8-2-1-3-9-25/h4-7,10-11H,1-3,8-9,12H2,(H,24,26) |
| InChIKey | OKCGHGCPSIVFOU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |