C19H17Cl2FN2O6S — CID 55313620
[2-(2,3-dichloroanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 55313620) has the molecular formula C19H17Cl2FN2O6S and a molecular weight of 491.32 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55313620 |
| Molecular Formula | C19H17Cl2FN2O6S |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H17Cl2FN2O6S/c20-13-2-1-3-15(18(13)21)23-17(25)11-30-19(26)12-4-5-14(22)16(10-12)31(27,28)24-6-8-29-9-7-24/h1-5,10H,6-9,11H2,(H,23,25) |
| InChIKey | YQPSODHYIDFLDK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |