C20H18FN3O6S — CID 4853608
[2-(4-cyanoanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 4853608) has the molecular formula C20H18FN3O6S and a molecular weight of 447.44 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4853608 |
| Molecular Formula | C20H18FN3O6S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)c2ccc(F)c(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C20H18FN3O6S/c21-17-6-3-15(11-18(17)31(27,28)24-7-9-29-10-8-24)20(26)30-13-19(25)23-16-4-1-14(12-22)2-5-16/h1-6,11H,7-10,13H2,(H,23,25) |
| InChIKey | ZGTXTSOXHUYYJM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |