C20H20ClFN2O6S — CID 2111334
[2-(5-chloro-2-methylanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2111334) has the molecular formula C20H20ClFN2O6S and a molecular weight of 470.91 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2111334 |
| Molecular Formula | C20H20ClFN2O6S |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H20ClFN2O6S/c1-13-2-4-15(21)11-17(13)23-19(25)12-30-20(26)14-3-5-16(22)18(10-14)31(27,28)24-6-8-29-9-7-24/h2-5,10-11H,6-9,12H2,1H3,(H,23,25) |
| InChIKey | SCCRTHJYFORAKY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |