C22H25FN2O6S — CID 2464166
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2464166) has the molecular formula C22H25FN2O6S and a molecular weight of 464.52 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2464166 |
| Molecular Formula | C22H25FN2O6S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H25FN2O6S/c1-3-16-6-4-5-15(2)21(16)24-20(26)14-31-22(27)17-7-8-18(23)19(13-17)32(28,29)25-9-11-30-12-10-25/h4-8,13H,3,9-12,14H2,1-2H3,(H,24,26) |
| InChIKey | AJIYWMKWCWFKBB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |