C22H26N2O6S — CID 55313549
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 55313549) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55313549 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H26N2O6S/c1-3-17-7-4-6-16(2)21(17)23-20(25)15-30-22(26)18-8-5-9-19(14-18)31(27,28)24-10-12-29-13-11-24/h4-9,14H,3,10-13,15H2,1-2H3,(H,23,25) |
| InChIKey | AXWBSRTYUWZGGS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |