C22H25NO6S — CID 42964870
[2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 42964870) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 42964870 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)c(C)c1 |
| InChI | InChI=1S/C22H25NO6S/c1-15-11-16(2)21(17(3)12-15)20(24)14-29-22(25)18-5-4-6-19(13-18)30(26,27)23-7-9-28-10-8-23/h4-6,11-13H,7-10,14H2,1-3H3 |
| InChIKey | ZMHKNRMMDWNVCJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |