C20H22N2O8S2 — CID 25044862
[2-(3-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 25044862) has the molecular formula C20H22N2O8S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 25044862 |
| Molecular Formula | C20H22N2O8S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C20H22N2O8S2/c1-21-31(25,26)17-6-3-5-16(13-17)20(24)30-14-19(23)15-4-2-7-18(12-15)32(27,28)22-8-10-29-11-9-22/h2-7,12-13,21H,8-11,14H2,1H3 |
| InChIKey | CGKPPRMNCPETFF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |