C13H17NO5S — CID 793747
ethyl 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 793747) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is ethyl 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | ethyl 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 793747 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | ethyl 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCOC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-2-19-13(15)11-4-3-5-12(10-11)20(16,17)14-6-8-18-9-7-14/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | ZFRGTRQJVGNREC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |