C23H26N2O8S — CID 26874310
diethyl 5-[(3-morpholin-4-ylsulfonylbenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 26874310) has the molecular formula C23H26N2O8S and a molecular weight of 490.53 g/mol. Its IUPAC name is diethyl 5-[(3-morpholin-4-ylsulfonylbenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[(3-morpholin-4-ylsulfonylbenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 26874310 |
| Molecular Formula | C23H26N2O8S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | diethyl 5-[(3-morpholin-4-ylsulfonylbenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C23H26N2O8S/c1-3-32-22(27)17-12-18(23(28)33-4-2)14-19(13-17)24-21(26)16-6-5-7-20(15-16)34(29,30)25-8-10-31-11-9-25/h5-7,12-15H,3-4,8-11H2,1-2H3,(H,24,26) |
| InChIKey | FAJRSTJPOSQVHW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |