C25H31N3O7S — CID 4832026
ethyl 4-[[3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoyl]amino]benzoate (PubChem CID 4832026) has the molecular formula C25H31N3O7S and a molecular weight of 517.60 g/mol. Its IUPAC name is ethyl 4-[[3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 4832026 |
| Molecular Formula | C25H31N3O7S |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | ethyl 4-[[3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(NC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)C(C)C)cc1 |
| InChI | InChI=1S/C25H31N3O7S/c1-4-35-25(31)18-8-10-20(11-9-18)26-24(30)22(17(2)3)27-23(29)19-6-5-7-21(16-19)36(32,33)28-12-14-34-15-13-28/h5-11,16-17,22H,4,12-15H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | XEZVFKUGYHZHMH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |