C23H26N4O5S — CID 2093007
N-[(2R)-1-(3-cyanoanilino)-3-methyl-1-oxobutan-2-yl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 2093007) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[(2R)-1-(3-cyanoanilino)-3-methyl-1-oxobutan-2-yl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(2R)-1-(3-cyanoanilino)-3-methyl-1-oxobutan-2-yl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2093007 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[(2R)-1-(3-cyanoanilino)-3-methyl-1-oxobutan-2-yl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C23H26N4O5S/c1-16(2)21(23(29)25-19-7-3-5-17(13-19)15-24)26-22(28)18-6-4-8-20(14-18)33(30,31)27-9-11-32-12-10-27/h3-8,13-14,16,21H,9-12H2,1-2H3,(H,25,29)(H,26,28)/t21-/m1/s1 |
| InChIKey | FYAVPSSBKKFGEN-OAQYLSRUSA-N |
| XLogP | 1.97 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |