C20H27N3O6S — CID 55934943
3-cyanopropyl (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate (PubChem CID 55934943) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-cyanopropyl (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate.
| Compound Name | 3-cyanopropyl (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55934943 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-cyanopropyl (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C(=O)OCCCC#N |
| InChI | InChI=1S/C20H27N3O6S/c1-15(2)18(20(25)29-11-4-3-8-21)22-19(24)16-6-5-7-17(14-16)30(26,27)23-9-12-28-13-10-23/h5-7,14-15,18H,3-4,9-13H2,1-2H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | NNUWGKLPBFLBGC-SFHVURJKSA-N |
| XLogP | 1.31 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|