C22H28N4O7S — CID 92787226
[(Z)-4-amino-3-cyano-2-oxopent-3-enyl] (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate (PubChem CID 92787226) has the molecular formula C22H28N4O7S and a molecular weight of 492.55 g/mol. Its IUPAC name is [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate.
| Compound Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 92787226 |
| Molecular Formula | C22H28N4O7S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate |
| SMILES | C/C(N)=C(\C#N)C(=O)COC(=O)[C@@H](NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C(C)C |
| InChI | InChI=1S/C22H28N4O7S/c1-14(2)20(22(29)33-13-19(27)18(12-23)15(3)24)25-21(28)16-5-4-6-17(11-16)34(30,31)26-7-9-32-10-8-26/h4-6,11,14,20H,7-10,13,24H2,1-3H3,(H,25,28)/b18-15-/t20-/m0/s1 |
| InChIKey | OQGDXASQOLXGCD-PUWPPSGDSA-N |
| XLogP | 0.33 |
| TPSA | 168.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|