C21H29N3O7S — CID 55925709
[2-oxo-2-(prop-2-enylamino)ethyl] (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate (PubChem CID 55925709) has the molecular formula C21H29N3O7S and a molecular weight of 467.54 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55925709 |
| Molecular Formula | C21H29N3O7S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] (2S)-3-methyl-2-[(3-morpholin-4-ylsulfonylbenzoyl)amino]butanoate |
| SMILES | C=CCNC(=O)COC(=O)[C@@H](NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C(C)C |
| InChI | InChI=1S/C21H29N3O7S/c1-4-8-22-18(25)14-31-21(27)19(15(2)3)23-20(26)16-6-5-7-17(13-16)32(28,29)24-9-11-30-12-10-24/h4-7,13,15,19H,1,8-12,14H2,2-3H3,(H,22,25)(H,23,26)/t19-/m0/s1 |
| InChIKey | LIGSEEXMRBXXCP-IBGZPJMESA-N |
| XLogP | 0.31 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|