C20H23N3O5S2 — CID 19680395
ethyl 4-[(3-morpholin-4-ylsulfonylphenyl)carbamothioylamino]benzoate (PubChem CID 19680395) has the molecular formula C20H23N3O5S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is ethyl 4-[(3-morpholin-4-ylsulfonylphenyl)carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[(3-morpholin-4-ylsulfonylphenyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 19680395 |
| Molecular Formula | C20H23N3O5S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | ethyl 4-[(3-morpholin-4-ylsulfonylphenyl)carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C20H23N3O5S2/c1-2-28-19(24)15-6-8-16(9-7-15)21-20(29)22-17-4-3-5-18(14-17)30(25,26)23-10-12-27-13-11-23/h3-9,14H,2,10-13H2,1H3,(H2,21,22,29) |
| InChIKey | PBGUSUPTTNYARW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|