C20H23N3O7S3 — CID 19680437
dimethyl 3-methyl-5-[(3-morpholin-4-ylsulfonylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate (PubChem CID 19680437) has the molecular formula C20H23N3O7S3 and a molecular weight of 513.62 g/mol. Its IUPAC name is dimethyl 3-methyl-5-[(3-morpholin-4-ylsulfonylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-[(3-morpholin-4-ylsulfonylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19680437 |
| Molecular Formula | C20H23N3O7S3 |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | dimethyl 3-methyl-5-[(3-morpholin-4-ylsulfonylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=S)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C20H23N3O7S3/c1-12-15(18(24)28-2)17(32-16(12)19(25)29-3)22-20(31)21-13-5-4-6-14(11-13)33(26,27)23-7-9-30-10-8-23/h4-6,11H,7-10H2,1-3H3,(H2,21,22,31) |
| InChIKey | WYPYALOFYGHANA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|